C47H38Cl2N8O3 — CID 10306284
2-[4-[4-(3,5-diphenyltetrazol-2-ium-2-yl)-3-methoxyphenyl]-2-methoxyphenyl]-5-[4-(4-methoxyphenyl)phenyl]-3-phenyltetrazol-2-ium dichloride (PubChem CID 10306284) has the molecular formula C47H38Cl2N8O3 and a molecular weight of 833.78 g/mol. Its IUPAC name is 2-[4-[4-(3,5-diphenyltetrazol-2-ium-2-yl)-3-methoxyphenyl]-2-methoxyphenyl]-5-[4-(4-methoxyphenyl)phenyl]-3-phenyltetrazol-2-ium dichloride.
| Compound Name | 2-[4-[4-(3,5-diphenyltetrazol-2-ium-2-yl)-3-methoxyphenyl]-2-methoxyphenyl]-5-[4-(4-methoxyphenyl)phenyl]-3-phenyltetrazol-2-ium dichloride |
|---|---|
| PubChem CID | 10306284 |
| Molecular Formula | C47H38Cl2N8O3 |
| Molecular Weight | 833.78 g/mol |
| Exact Mass | 832.24 |
| IUPAC Name | 2-[4-[4-(3,5-diphenyltetrazol-2-ium-2-yl)-3-methoxyphenyl]-2-methoxyphenyl]-5-[4-(4-methoxyphenyl)phenyl]-3-phenyltetrazol-2-ium dichloride |
| SMILES | COc1ccc(-c2ccc(-c3nn(-c4ccccc4)[n+](-c4ccc(-c5ccc(-[n+]6nc(-c7ccccc7)nn6-c6ccccc6)c(OC)c5)cc4OC)n3)cc2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C47H38N8O3.2ClH/c1-56-41-27-23-34(24-28-41)33-19-21-36(22-20-33)47-49-53(40-17-11-6-12-18-40)55(51-47)43-30-26-38(32-45(43)58-3)37-25-29-42(44(31-37)57-2)54-50-46(35-13-7-4-8-14-35)48-52(54)39-15-9-5-10-16-39;;/h4-32H,1-3H3;2*1H/q+2;;/p-2 |
| InChIKey | RGMPBBBCBVTQHD-UHFFFAOYSA-L |
| XLogP | 2.10 |
| TPSA | 96.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.78 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|