C26H23N4+ — CID 158764972
2,3-diphenyl-5-(3-phenylphenyl)tetrazol-2-ium;methane (PubChem CID 158764972) has the molecular formula C26H23N4+ and a molecular weight of 391.50 g/mol. Its IUPAC name is 2,3-diphenyl-5-(3-phenylphenyl)tetrazol-2-ium;methane.
| Compound Name | 2,3-diphenyl-5-(3-phenylphenyl)tetrazol-2-ium;methane |
|---|---|
| PubChem CID | 158764972 |
| Molecular Formula | C26H23N4+ |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2,3-diphenyl-5-(3-phenylphenyl)tetrazol-2-ium;methane |
| SMILES | C.c1ccc(-c2cccc(-c3nn(-c4ccccc4)[n+](-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C25H19N4.CH4/c1-4-11-20(12-5-1)21-13-10-14-22(19-21)25-26-28(23-15-6-2-7-16-23)29(27-25)24-17-8-3-9-18-24;/h1-19H;1H4/q+1; |
| InChIKey | IPDHMWRRQZNZRE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|