C17H19N4+ — CID 2916216
5-butyl-2,3-diphenyltetrazol-2-ium (PubChem CID 2916216) has the molecular formula C17H19N4+ and a molecular weight of 279.37 g/mol. Its IUPAC name is 5-butyl-2,3-diphenyltetrazol-2-ium.
| Compound Name | 5-butyl-2,3-diphenyltetrazol-2-ium |
|---|---|
| PubChem CID | 2916216 |
| Molecular Formula | C17H19N4+ |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 5-butyl-2,3-diphenyltetrazol-2-ium |
| SMILES | CCCCc1nn(-c2ccccc2)[n+](-c2ccccc2)n1 |
| InChI | InChI=1S/C17H19N4/c1-2-3-14-17-18-20(15-10-6-4-7-11-15)21(19-17)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3/q+1 |
| InChIKey | FMWQHEBABAZGEO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|