C19H19Cl2N2+ — CID 156678868
4-butyl-3,5-dichloro-1,2-diphenylpyrazol-2-ium (PubChem CID 156678868) has the molecular formula C19H19Cl2N2+ and a molecular weight of 346.28 g/mol. Its IUPAC name is 4-butyl-3,5-dichloro-1,2-diphenylpyrazol-2-ium.
| Compound Name | 4-butyl-3,5-dichloro-1,2-diphenylpyrazol-2-ium |
|---|---|
| PubChem CID | 156678868 |
| Molecular Formula | C19H19Cl2N2+ |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 4-butyl-3,5-dichloro-1,2-diphenylpyrazol-2-ium |
| SMILES | CCCCc1c(Cl)n(-c2ccccc2)[n+](-c2ccccc2)c1Cl |
| InChI | InChI=1S/C19H19Cl2N2/c1-2-3-14-17-18(20)22(15-10-6-4-7-11-15)23(19(17)21)16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3/q+1 |
| InChIKey | GSBVEWUHMCPDME-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|