C19H23ClN4 — CID 15115086
5-hexyl-2,3-diphenyltetrazol-2-ium chloride (PubChem CID 15115086) has the molecular formula C19H23ClN4 and a molecular weight of 342.87 g/mol. Its IUPAC name is 5-hexyl-2,3-diphenyltetrazol-2-ium chloride.
| Compound Name | 5-hexyl-2,3-diphenyltetrazol-2-ium chloride |
|---|---|
| PubChem CID | 15115086 |
| Molecular Formula | C19H23ClN4 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 5-hexyl-2,3-diphenyltetrazol-2-ium chloride |
| SMILES | CCCCCCc1nn(-c2ccccc2)[n+](-c2ccccc2)n1.[Cl-] |
| InChI | InChI=1S/C19H23N4.ClH/c1-2-3-4-11-16-19-20-22(17-12-7-5-8-13-17)23(21-19)18-14-9-6-10-15-18;/h5-10,12-15H,2-4,11,16H2,1H3;1H/q+1;/p-1 |
| InChIKey | BQWUTXUWRXJYNC-UHFFFAOYSA-M |
| XLogP | 0.67 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|