C40H32Cl2N8O2 — CID 44888661
2-[3-[4-(3,5-diphenyltetrazol-3-ium-2-yl)-2-methoxyphenyl]-4-methoxyphenyl]-3,5-diphenyltetrazol-3-ium dichloride (PubChem CID 44888661) has the molecular formula C40H32Cl2N8O2 and a molecular weight of 727.66 g/mol. Its IUPAC name is 2-[3-[4-(3,5-diphenyltetrazol-3-ium-2-yl)-2-methoxyphenyl]-4-methoxyphenyl]-3,5-diphenyltetrazol-3-ium dichloride.
| Compound Name | 2-[3-[4-(3,5-diphenyltetrazol-3-ium-2-yl)-2-methoxyphenyl]-4-methoxyphenyl]-3,5-diphenyltetrazol-3-ium dichloride |
|---|---|
| PubChem CID | 44888661 |
| Molecular Formula | C40H32Cl2N8O2 |
| Molecular Weight | 727.66 g/mol |
| Exact Mass | 726.20 |
| IUPAC Name | 2-[3-[4-(3,5-diphenyltetrazol-3-ium-2-yl)-2-methoxyphenyl]-4-methoxyphenyl]-3,5-diphenyltetrazol-3-ium dichloride |
| SMILES | COc1cc(-n2nc(-c3ccccc3)n[n+]2-c2ccccc2)ccc1-c1cc(-n2nc(-c3ccccc3)n[n+]2-c2ccccc2)ccc1OC.[Cl-].[Cl-] |
| InChI | InChI=1S/C40H32N8O2.2ClH/c1-49-37-26-24-33(47-43-39(29-15-7-3-8-16-29)41-45(47)31-19-11-5-12-20-31)27-36(37)35-25-23-34(28-38(35)50-2)48-44-40(30-17-9-4-10-18-30)42-46(48)32-21-13-6-14-22-32;;/h3-28H,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | PTUYSNCREKKWJO-UHFFFAOYSA-L |
| XLogP | 0.43 |
| TPSA | 87.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.66 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|