C40H34N8O2+4 — CID 135602127
3-[4-[4-(3,5-diphenyltetrazole-2,4-diium-2-yl)-3-methoxyphenyl]-2-methoxyphenyl]-2,5-diphenyltetrazole-1,3-diium (PubChem CID 135602127) has the molecular formula C40H34N8O2+4 and a molecular weight of 658.77 g/mol. Its IUPAC name is 3-[4-[4-(3,5-diphenyltetrazole-2,4-diium-2-yl)-3-methoxyphenyl]-2-methoxyphenyl]-2,5-diphenyltetrazole-1,3-diium.
| Compound Name | 3-[4-[4-(3,5-diphenyltetrazole-2,4-diium-2-yl)-3-methoxyphenyl]-2-methoxyphenyl]-2,5-diphenyltetrazole-1,3-diium |
|---|---|
| PubChem CID | 135602127 |
| Molecular Formula | C40H34N8O2+4 |
| Molecular Weight | 658.77 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | 3-[4-[4-(3,5-diphenyltetrazole-2,4-diium-2-yl)-3-methoxyphenyl]-2-methoxyphenyl]-2,5-diphenyltetrazole-1,3-diium |
| SMILES | COc1cc(-c2ccc(-[n+]3nc(-c4ccccc4)[nH+]n3-c3ccccc3)c(OC)c2)ccc1-[n+]1nc(-c2ccccc2)[nH+]n1-c1ccccc1 |
| InChI | InChI=1S/C40H32N8O2/c1-49-37-27-31(23-25-35(37)47-43-39(29-15-7-3-8-16-29)41-45(47)33-19-11-5-12-20-33)32-24-26-36(38(28-32)50-2)48-44-40(30-17-9-4-10-18-30)42-46(48)34-21-13-6-14-22-34/h3-28H,1-2H3/q+2/p+2 |
| InChIKey | IPHKOIQHBLKHPT-UHFFFAOYSA-P |
| XLogP | 5.26 |
| TPSA | 90.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.77 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|