C14H12N2O2 — CID 151157986
8-methoxy-2-methylpyrido[2,1-b]quinazolin-11-one (PubChem CID 151157986) has the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. Its IUPAC name is 8-methoxy-2-methylpyrido[2,1-b]quinazolin-11-one.
| Compound Name | 8-methoxy-2-methylpyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 151157986 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 8-methoxy-2-methylpyrido[2,1-b]quinazolin-11-one |
| SMILES | COc1ccc2nc3ccc(C)cc3c(=O)n2c1 |
| InChI | InChI=1S/C14H12N2O2/c1-9-3-5-12-11(7-9)14(17)16-8-10(18-2)4-6-13(16)15-12/h3-8H,1-2H3 |
| InChIKey | MZQNCVARMPLBAX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|