C16H16N2O3 — CID 20525676
8-(hydroxymethyl)-2-propan-2-yloxypyrido[2,1-b]quinazolin-11-one (PubChem CID 20525676) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 8-(hydroxymethyl)-2-propan-2-yloxypyrido[2,1-b]quinazolin-11-one.
| Compound Name | 8-(hydroxymethyl)-2-propan-2-yloxypyrido[2,1-b]quinazolin-11-one |
|---|---|
| PubChem CID | 20525676 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 8-(hydroxymethyl)-2-propan-2-yloxypyrido[2,1-b]quinazolin-11-one |
| SMILES | CC(C)Oc1ccc2nc3ccc(CO)cn3c(=O)c2c1 |
| InChI | InChI=1S/C16H16N2O3/c1-10(2)21-12-4-5-14-13(7-12)16(20)18-8-11(9-19)3-6-15(18)17-14/h3-8,10,19H,9H2,1-2H3 |
| InChIKey | GYHWPHABJUOVCU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|