C17H16N2O7S — CID 15117624
(1R,4R,5R,8R)-4-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-3,10-dioxo-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid (PubChem CID 15117624) has the molecular formula C17H16N2O7S and a molecular weight of 392.39 g/mol. Its IUPAC name is (1R,4R,5R,8R)-4-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-3,10-dioxo-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid.
| Compound Name | (1R,4R,5R,8R)-4-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-3,10-dioxo-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
|---|---|
| PubChem CID | 15117624 |
| Molecular Formula | C17H16N2O7S |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | (1R,4R,5R,8R)-4-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-3,10-dioxo-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
| SMILES | O=C1C[C@H]2CS[C@@H]3[C@H](NC(=O)[C@H](O)c4ccccc4)C(=O)N3[C@@]2(C(=O)O)O1 |
| InChI | InChI=1S/C17H16N2O7S/c20-10-6-9-7-27-15-11(14(23)19(15)17(9,26-10)16(24)25)18-13(22)12(21)8-4-2-1-3-5-8/h1-5,9,11-12,15,21H,6-7H2,(H,18,22)(H,24,25)/t9-,11+,12+,15+,17+/m0/s1 |
| InChIKey | SVLYDGFNLSPXOY-SVVGILSMSA-N |
| XLogP | -0.54 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |