C17H15N2NaO6S — CID 23700643
sodium (1S,4R,5R,8S)-3,10-dioxo-4-[(2-phenylacetyl)amino]-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate (PubChem CID 23700643) has the molecular formula C17H15N2NaO6S and a molecular weight of 398.37 g/mol. Its IUPAC name is sodium (1S,4R,5R,8S)-3,10-dioxo-4-[(2-phenylacetyl)amino]-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate.
| Compound Name | sodium (1S,4R,5R,8S)-3,10-dioxo-4-[(2-phenylacetyl)amino]-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate |
|---|---|
| PubChem CID | 23700643 |
| Molecular Formula | C17H15N2NaO6S |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | sodium (1S,4R,5R,8S)-3,10-dioxo-4-[(2-phenylacetyl)amino]-11-oxa-6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate |
| SMILES | O=C(Cc1ccccc1)N[C@@H]1C(=O)N2[C@@H]1SC[C@H]1CC(=O)O[C@]12C(=O)[O-].[Na+] |
| InChI | InChI=1S/C17H16N2O6S.Na/c20-11(6-9-4-2-1-3-5-9)18-13-14(22)19-15(13)26-8-10-7-12(21)25-17(10,19)16(23)24;/h1-5,10,13,15H,6-8H2,(H,18,20)(H,23,24);/q;+1/p-1/t10-,13-,15-,17+;/m1./s1 |
| InChIKey | BYJVYJAUCXSQMH-UJRUQBPGSA-M |
| XLogP | -4.36 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | -4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |