C22H20Cl2N2O4S — CID 70468853
benzyl (5R)-3,3-dichloro-2-methyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70468853) has the molecular formula C22H20Cl2N2O4S and a molecular weight of 479.39 g/mol. Its IUPAC name is benzyl (5R)-3,3-dichloro-2-methyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | benzyl (5R)-3,3-dichloro-2-methyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70468853 |
| Molecular Formula | C22H20Cl2N2O4S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | benzyl (5R)-3,3-dichloro-2-methyl-7-oxo-6-[(2-phenylacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C(=O)OCc2ccccc2)N2C(=O)C(NC(=O)Cc3ccccc3)[C@H]2SC1(Cl)Cl |
| InChI | InChI=1S/C22H20Cl2N2O4S/c1-21(20(29)30-13-15-10-6-3-7-11-15)22(23,24)31-19-17(18(28)26(19)21)25-16(27)12-14-8-4-2-5-9-14/h2-11,17,19H,12-13H2,1H3,(H,25,27)/t17?,19-,21?/m1/s1 |
| InChIKey | HIPSXGJKUXNDHN-MOMVYJMYSA-N |
| XLogP | 3.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|