C28H58O4 — CID 151178773
10,10-dimethyl-1-[3-(trimethoxymethyl)undecoxy]undecane (PubChem CID 151178773) has the molecular formula C28H58O4 and a molecular weight of 458.77 g/mol. Its IUPAC name is 10,10-dimethyl-1-[3-(trimethoxymethyl)undecoxy]undecane.
| Compound Name | 10,10-dimethyl-1-[3-(trimethoxymethyl)undecoxy]undecane |
|---|---|
| PubChem CID | 151178773 |
| Molecular Formula | C28H58O4 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 458.43 |
| IUPAC Name | 10,10-dimethyl-1-[3-(trimethoxymethyl)undecoxy]undecane |
| SMILES | CCCCCCCCC(CCOCCCCCCCCCC(C)(C)C)C(OC)(OC)OC |
| InChI | InChI=1S/C28H58O4/c1-8-9-10-11-15-18-21-26(28(29-5,30-6)31-7)22-25-32-24-20-17-14-12-13-16-19-23-27(2,3)4/h26H,8-25H2,1-7H3 |
| InChIKey | NDVOKJBMQGANOW-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|