C6H8Cl4O — CID 151180426
1,1,1,3-tetrachloro-3-methylpentan-2-one (PubChem CID 151180426) has the molecular formula C6H8Cl4O and a molecular weight of 237.94 g/mol. Its IUPAC name is 1,1,1,3-tetrachloro-3-methylpentan-2-one.
| Compound Name | 1,1,1,3-tetrachloro-3-methylpentan-2-one |
|---|---|
| PubChem CID | 151180426 |
| Molecular Formula | C6H8Cl4O |
| Molecular Weight | 237.94 g/mol |
| Exact Mass | 235.93 |
| IUPAC Name | 1,1,1,3-tetrachloro-3-methylpentan-2-one |
| SMILES | CCC(C)(Cl)C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H8Cl4O/c1-3-5(2,7)4(11)6(8,9)10/h3H2,1-2H3 |
| InChIKey | NEEFGSXYHYRVRK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.94 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|