About 2,2-dichloro-4,4-difluoro-3-oxohexanal
2,2-dichloro-4,4-difluoro-3-oxohexanal (PubChem CID 134229742) has the molecular formula C6H6Cl2F2O2
and a molecular weight of 219.01 g/mol. Its IUPAC name is 2,2-dichloro-4,4-difluoro-3-oxohexanal.
Molecular Properties
| Compound Name | 2,2-dichloro-4,4-difluoro-3-oxohexanal |
| PubChem CID | 134229742 |
| Molecular Formula | C6H6Cl2F2O2 |
| Molecular Weight | 219.01 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 2,2-dichloro-4,4-difluoro-3-oxohexanal |
| SMILES | CCC(F)(F)C(=O)C(Cl)(Cl)C=O |
| InChI | InChI=1S/C6H6Cl2F2O2/c1-2-6(9,10)4(12)5(7,8)3-11/h3H,2H2,1H3 |
| InChIKey | CIFNKJZYSHGMJB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.01 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dichloro-4,4-difluoro-3-oxohexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dichloro-4,4-difluoro-3-oxohexanal?
The IUPAC name of 2,2-dichloro-4,4-difluoro-3-oxohexanal (CID 134229742) is 2,2-dichloro-4,4-difluoro-3-oxohexanal.
What is the SMILES notation for 2,2-dichloro-4,4-difluoro-3-oxohexanal?
The canonical SMILES for 2,2-dichloro-4,4-difluoro-3-oxohexanal is CCC(F)(F)C(=O)C(Cl)(Cl)C=O.
What is the InChIKey of 2,2-dichloro-4,4-difluoro-3-oxohexanal?
The InChIKey is CIFNKJZYSHGMJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl2F2O2/c1-2-6(9,10)4(12)5(7,8)3-11/h3H,2H2,1H3.
What are the key properties of 2,2-dichloro-4,4-difluoro-3-oxohexanal?
2,2-dichloro-4,4-difluoro-3-oxohexanal has a molecular weight of 219.01 g/mol, XLogP of 1.97, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dichloro-4,4-difluoro-3-oxohexanal is sourced from PubChem (CID 134229742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).