C6H6Cl2F2O2 — CID 134229742
2,2-dichloro-4,4-difluoro-3-oxohexanal (PubChem CID 134229742) has the molecular formula C6H6Cl2F2O2 and a molecular weight of 219.01 g/mol. Its IUPAC name is 2,2-dichloro-4,4-difluoro-3-oxohexanal.
| Compound Name | 2,2-dichloro-4,4-difluoro-3-oxohexanal |
|---|---|
| PubChem CID | 134229742 |
| Molecular Formula | C6H6Cl2F2O2 |
| Molecular Weight | 219.01 g/mol |
| Exact Mass | 217.97 |
| IUPAC Name | 2,2-dichloro-4,4-difluoro-3-oxohexanal |
| SMILES | CCC(F)(F)C(=O)C(Cl)(Cl)C=O |
| InChI | InChI=1S/C6H6Cl2F2O2/c1-2-6(9,10)4(12)5(7,8)3-11/h3H,2H2,1H3 |
| InChIKey | CIFNKJZYSHGMJB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.01 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|