C27H29NO6 — CID 15120581
4,4-bis(3,5-dimethoxyphenyl)-N-(4-methoxyphenyl)but-3-enamide (PubChem CID 15120581) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 4,4-bis(3,5-dimethoxyphenyl)-N-(4-methoxyphenyl)but-3-enamide.
| Compound Name | 4,4-bis(3,5-dimethoxyphenyl)-N-(4-methoxyphenyl)but-3-enamide |
|---|---|
| PubChem CID | 15120581 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 4,4-bis(3,5-dimethoxyphenyl)-N-(4-methoxyphenyl)but-3-enamide |
| SMILES | COc1ccc(NC(=O)CC=C(c2cc(OC)cc(OC)c2)c2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C27H29NO6/c1-30-21-8-6-20(7-9-21)28-27(29)11-10-26(18-12-22(31-2)16-23(13-18)32-3)19-14-24(33-4)17-25(15-19)34-5/h6-10,12-17H,11H2,1-5H3,(H,28,29) |
| InChIKey | DXQTZDOOJMWDJI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |