C11H14N4O — CID 151208886
N-(2-azidophenyl)-2,2-dimethylpropanamide (PubChem CID 151208886) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is N-(2-azidophenyl)-2,2-dimethylpropanamide.
| Compound Name | N-(2-azidophenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 151208886 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | N-(2-azidophenyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C11H14N4O/c1-11(2,3)10(16)13-8-6-4-5-7-9(8)14-15-12/h4-7H,1-3H3,(H,13,16) |
| InChIKey | NJVZTKPCGSDFKN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|