C8H15N3O4 — CID 15121590
2-amino-4,5-diethoxy-5-hydroxy-1,4-dihydropyrimidin-6-one (PubChem CID 15121590) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-amino-4,5-diethoxy-5-hydroxy-1,4-dihydropyrimidin-6-one.
| Compound Name | 2-amino-4,5-diethoxy-5-hydroxy-1,4-dihydropyrimidin-6-one |
|---|---|
| PubChem CID | 15121590 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 2-amino-4,5-diethoxy-5-hydroxy-1,4-dihydropyrimidin-6-one |
| SMILES | CCOC1N=C(N)NC(=O)C1(O)OCC |
| InChI | InChI=1S/C8H15N3O4/c1-3-14-6-8(13,15-4-2)5(12)10-7(9)11-6/h6,13H,3-4H2,1-2H3,(H3,9,10,11,12) |
| InChIKey | GNGYKEIKNUPPAA-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|