C7H9N3O3 — CID 176534108
2-amino-5-ethoxy-4-(oxomethylidene)-1H-pyrimidin-6-one (PubChem CID 176534108) has the molecular formula C7H9N3O3 and a molecular weight of 183.17 g/mol. Its IUPAC name is 2-amino-5-ethoxy-4-(oxomethylidene)-1H-pyrimidin-6-one.
| Compound Name | 2-amino-5-ethoxy-4-(oxomethylidene)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 176534108 |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 2-amino-5-ethoxy-4-(oxomethylidene)-1H-pyrimidin-6-one |
| SMILES | CCOC1C(=O)NC(N)=NC1=C=O |
| InChI | InChI=1S/C7H9N3O3/c1-2-13-5-4(3-11)9-7(8)10-6(5)12/h5H,2H2,1H3,(H3,8,9,10,12) |
| InChIKey | VDJBBZPMXWXPAT-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|