C9H13NO3 — CID 102343500
3-ethoxy-4-propan-2-yliminocyclobutane-1,2-dione (PubChem CID 102343500) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-ethoxy-4-propan-2-yliminocyclobutane-1,2-dione.
| Compound Name | 3-ethoxy-4-propan-2-yliminocyclobutane-1,2-dione |
|---|---|
| PubChem CID | 102343500 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 3-ethoxy-4-propan-2-yliminocyclobutane-1,2-dione |
| SMILES | CCOC1C(=O)C(=O)/C1=N/C(C)C |
| InChI | InChI=1S/C9H13NO3/c1-4-13-9-6(10-5(2)3)7(11)8(9)12/h5,9H,4H2,1-3H3/b10-6- |
| InChIKey | KBGZFVPWNDORGR-POHAHGRESA-N |
| XLogP | 0.39 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|