C9H15NO2S — CID 13117703
2-ethoxy-4-propan-2-yl-1,4-thiazin-3-one (PubChem CID 13117703) has the molecular formula C9H15NO2S and a molecular weight of 201.29 g/mol. Its IUPAC name is 2-ethoxy-4-propan-2-yl-1,4-thiazin-3-one.
| Compound Name | 2-ethoxy-4-propan-2-yl-1,4-thiazin-3-one |
|---|---|
| PubChem CID | 13117703 |
| Molecular Formula | C9H15NO2S |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 2-ethoxy-4-propan-2-yl-1,4-thiazin-3-one |
| SMILES | CCOC1SC=CN(C(C)C)C1=O |
| InChI | InChI=1S/C9H15NO2S/c1-4-12-9-8(11)10(7(2)3)5-6-13-9/h5-7,9H,4H2,1-3H3 |
| InChIKey | YYTSLQFQXWANTR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |