C9H11NO6 — CID 102129146
ethyl 4-acetyl-3-hydroxy-2,5-dioxopyrrolidine-3-carboxylate (PubChem CID 102129146) has the molecular formula C9H11NO6 and a molecular weight of 229.19 g/mol. Its IUPAC name is ethyl 4-acetyl-3-hydroxy-2,5-dioxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 4-acetyl-3-hydroxy-2,5-dioxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 102129146 |
| Molecular Formula | C9H11NO6 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | ethyl 4-acetyl-3-hydroxy-2,5-dioxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(O)C(=O)NC(=O)C1C(C)=O |
| InChI | InChI=1S/C9H11NO6/c1-3-16-8(14)9(15)5(4(2)11)6(12)10-7(9)13/h5,15H,3H2,1-2H3,(H,10,12,13) |
| InChIKey | IZNRCSVBCMEBBD-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|