C8H10O4 — CID 174405716
trans-(2S,3S)-3-ethoxy-2-(hydroxymethyl)-4-(oxomethylidene)cyclobutan-1-one (PubChem CID 174405716) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is trans-(2S,3S)-3-ethoxy-2-(hydroxymethyl)-4-(oxomethylidene)cyclobutan-1-one.
| Compound Name | trans-(2S,3S)-3-ethoxy-2-(hydroxymethyl)-4-(oxomethylidene)cyclobutan-1-one |
|---|---|
| PubChem CID | 174405716 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | trans-(2S,3S)-3-ethoxy-2-(hydroxymethyl)-4-(oxomethylidene)cyclobutan-1-one |
| SMILES | CCO[C@@H]1C(=C=O)C(=O)[C@H]1CO |
| InChI | InChI=1S/C8H10O4/c1-2-12-8-5(3-9)7(11)6(8)4-10/h5,8-9H,2-3H2,1H3/t5-,8+/m1/s1 |
| InChIKey | DJBKLJAERKCZKP-XRGYYRRGSA-N |
| XLogP | -0.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|