C7H13FO2S — CID 15122106
trans-(1R,2R)-1-fluoro-2-methylsulfonylcyclohexane (PubChem CID 15122106) has the molecular formula C7H13FO2S and a molecular weight of 180.24 g/mol. Its IUPAC name is trans-(1R,2R)-1-fluoro-2-methylsulfonylcyclohexane.
| Compound Name | trans-(1R,2R)-1-fluoro-2-methylsulfonylcyclohexane |
|---|---|
| PubChem CID | 15122106 |
| Molecular Formula | C7H13FO2S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | trans-(1R,2R)-1-fluoro-2-methylsulfonylcyclohexane |
| SMILES | CS(=O)(=O)[C@@H]1CCCC[C@H]1F |
| InChI | InChI=1S/C7H13FO2S/c1-11(9,10)7-5-3-2-4-6(7)8/h6-7H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | HDQKLNKNEMASTK-RNFRBKRXSA-N |
| XLogP | 1.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |