C29H36O3Si3 — CID 15122160
trimethyl-[1-methyl-10,16-bis(trimethylsilyl)-8,14,22-trioxahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-4-yl]silane (PubChem CID 15122160) has the molecular formula C29H36O3Si3 and a molecular weight of 516.86 g/mol. Its IUPAC name is trimethyl-[1-methyl-10,16-bis(trimethylsilyl)-8,14,22-trioxahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-4-yl]silane.
| Compound Name | trimethyl-[1-methyl-10,16-bis(trimethylsilyl)-8,14,22-trioxahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-4-yl]silane |
|---|---|
| PubChem CID | 15122160 |
| Molecular Formula | C29H36O3Si3 |
| Molecular Weight | 516.86 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | trimethyl-[1-methyl-10,16-bis(trimethylsilyl)-8,14,22-trioxahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-4-yl]silane |
| SMILES | CC12c3c4ccc([Si](C)(C)C)c3Oc3ccc([Si](C)(C)C)c(c31)Oc1ccc([Si](C)(C)C)c(c12)O4 |
| InChI | InChI=1S/C29H36O3Si3/c1-29-23-17-11-14-20(33(2,3)4)26(23)30-18-12-15-21(34(5,6)7)27(24(18)29)32-19-13-16-22(35(8,9)10)28(31-17)25(19)29/h11-16H,1-10H3 |
| InChIKey | GYEFPBNEGVDONO-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.86 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|