C24H42Si4 — CID 57379548
[4-[3,4-bis(trimethylsilyl)phenyl]-2-trimethylsilylphenyl]-trimethylsilane (PubChem CID 57379548) has the molecular formula C24H42Si4 and a molecular weight of 442.94 g/mol. Its IUPAC name is [4-[3,4-bis(trimethylsilyl)phenyl]-2-trimethylsilylphenyl]-trimethylsilane.
| Compound Name | [4-[3,4-bis(trimethylsilyl)phenyl]-2-trimethylsilylphenyl]-trimethylsilane |
|---|---|
| PubChem CID | 57379548 |
| Molecular Formula | C24H42Si4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | [4-[3,4-bis(trimethylsilyl)phenyl]-2-trimethylsilylphenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(-c2ccc([Si](C)(C)C)c([Si](C)(C)C)c2)cc1[Si](C)(C)C |
| InChI | InChI=1S/C24H42Si4/c1-25(2,3)21-15-13-19(17-23(21)27(7,8)9)20-14-16-22(26(4,5)6)24(18-20)28(10,11)12/h13-18H,1-12H3 |
| InChIKey | PXFMQHUGYJVAJL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|