C19H26OSi2 — CID 11609549
[3,4-bis(trimethylsilyl)phenyl]-phenylmethanone (PubChem CID 11609549) has the molecular formula C19H26OSi2 and a molecular weight of 326.59 g/mol. Its IUPAC name is [3,4-bis(trimethylsilyl)phenyl]-phenylmethanone.
| Compound Name | [3,4-bis(trimethylsilyl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 11609549 |
| Molecular Formula | C19H26OSi2 |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | [3,4-bis(trimethylsilyl)phenyl]-phenylmethanone |
| SMILES | C[Si](C)(C)c1ccc(C(=O)c2ccccc2)cc1[Si](C)(C)C |
| InChI | InChI=1S/C19H26OSi2/c1-21(2,3)17-13-12-16(14-18(17)22(4,5)6)19(20)15-10-8-7-9-11-15/h7-14H,1-6H3 |
| InChIKey | XZRQOJRVKCGQSO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|