About CID 15123496
CID 15123496 (PubChem CID 15123496) has the molecular formula C13H36NOSi4
and a molecular weight of 334.78 g/mol.
Molecular Properties
| Compound Name | CID 15123496 |
| PubChem CID | 15123496 |
| Molecular Formula | C13H36NOSi4 |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[N]O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H36NOSi4/c1-13(2,3)14-15-19(16(4,5)6,17(7,8)9)18(10,11)12/h1-12H3 |
| InChIKey | BSHAPPZWGFVCMF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 15123496 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15123496?
The IUPAC name of CID 15123496 (CID 15123496) is not available.
What is the SMILES notation for CID 15123496?
The canonical SMILES for CID 15123496 is CC(C)(C)[N]O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of CID 15123496?
The InChIKey is BSHAPPZWGFVCMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H36NOSi4/c1-13(2,3)14-15-19(16(4,5)6,17(7,8)9)18(10,11)12/h1-12H3.
What are the key properties of CID 15123496?
CID 15123496 has a molecular weight of 334.78 g/mol, XLogP of 4.52, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15123496 is sourced from PubChem (CID 15123496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).