C12H10O3S — CID 151249659
6-(1-benzofuran-3-yl)-4H-1,3-oxathiine 3-oxide (PubChem CID 151249659) has the molecular formula C12H10O3S and a molecular weight of 234.28 g/mol. Its IUPAC name is 6-(1-benzofuran-3-yl)-4H-1,3-oxathiine 3-oxide.
| Compound Name | 6-(1-benzofuran-3-yl)-4H-1,3-oxathiine 3-oxide |
|---|---|
| PubChem CID | 151249659 |
| Molecular Formula | C12H10O3S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 6-(1-benzofuran-3-yl)-4H-1,3-oxathiine 3-oxide |
| SMILES | O=S1CC=C(c2coc3ccccc23)OC1 |
| InChI | InChI=1S/C12H10O3S/c13-16-6-5-12(15-8-16)10-7-14-11-4-2-1-3-9(10)11/h1-5,7H,6,8H2 |
| InChIKey | NSBARPNOCWLSMP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |