C15H24O6 — CID 151254159
2-ethenyldecane-1,1,1-tricarboxylic acid (PubChem CID 151254159) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-ethenyldecane-1,1,1-tricarboxylic acid.
| Compound Name | 2-ethenyldecane-1,1,1-tricarboxylic acid |
|---|---|
| PubChem CID | 151254159 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-ethenyldecane-1,1,1-tricarboxylic acid |
| SMILES | C=CC(CCCCCCCC)C(C(=O)O)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H24O6/c1-3-5-6-7-8-9-10-11(4-2)15(12(16)17,13(18)19)14(20)21/h4,11H,2-3,5-10H2,1H3,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | NSYWSQCNOHFYFV-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|