C18H29ClN2O — CID 151263073
1-(4-chloro-3-methoxyphenyl)-1-N',1-N'-dimethyl-1-N-(4-methylcyclohexyl)ethane-1,1-diamine (PubChem CID 151263073) has the molecular formula C18H29ClN2O and a molecular weight of 324.90 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-1-N',1-N'-dimethyl-1-N-(4-methylcyclohexyl)ethane-1,1-diamine.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-1-N',1-N'-dimethyl-1-N-(4-methylcyclohexyl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 151263073 |
| Molecular Formula | C18H29ClN2O |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-1-N',1-N'-dimethyl-1-N-(4-methylcyclohexyl)ethane-1,1-diamine |
| SMILES | COc1cc(C(C)(NC2CCC(C)CC2)N(C)C)ccc1Cl |
| InChI | InChI=1S/C18H29ClN2O/c1-13-6-9-15(10-7-13)20-18(2,21(3)4)14-8-11-16(19)17(12-14)22-5/h8,11-13,15,20H,6-7,9-10H2,1-5H3 |
| InChIKey | NUTFUDBCXJCTIX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|