C21H21N5O5S — CID 15126744
7-(benzylsulfanylmethyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimido[2,1-f]purin-9-one (PubChem CID 15126744) has the molecular formula C21H21N5O5S and a molecular weight of 455.50 g/mol. Its IUPAC name is 7-(benzylsulfanylmethyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimido[2,1-f]purin-9-one.
| Compound Name | 7-(benzylsulfanylmethyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimido[2,1-f]purin-9-one |
|---|---|
| PubChem CID | 15126744 |
| Molecular Formula | C21H21N5O5S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 7-(benzylsulfanylmethyl)-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimido[2,1-f]purin-9-one |
| SMILES | O=c1cc(CSCc2ccccc2)n2cnc3c(ncn3[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C21H21N5O5S/c27-7-14-17(29)18(30)21(31-14)26-10-22-16-19(26)23-11-25-13(6-15(28)24-20(16)25)9-32-8-12-4-2-1-3-5-12/h1-6,10-11,14,17-18,21,27,29-30H,7-9H2/t14-,17-,18-,21-/m1/s1 |
| InChIKey | KAGNNGDSWPIWGI-HAXDFEGKSA-N |
| XLogP | 0.48 |
| TPSA | 135.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |