C7H8F2O3S — CID 151267481
3,3-difluoro-4-methylcyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 151267481) has the molecular formula C7H8F2O3S and a molecular weight of 210.20 g/mol. Its IUPAC name is 3,3-difluoro-4-methylcyclohexa-1,5-diene-1-sulfonic acid.
| Compound Name | 3,3-difluoro-4-methylcyclohexa-1,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 151267481 |
| Molecular Formula | C7H8F2O3S |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 3,3-difluoro-4-methylcyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | CC1C=CC(S(=O)(=O)O)=CC1(F)F |
| InChI | InChI=1S/C7H8F2O3S/c1-5-2-3-6(13(10,11)12)4-7(5,8)9/h2-5H,1H3,(H,10,11,12) |
| InChIKey | NVQNVSYXXOZLGY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|