C17H18N4O2 — CID 151276183
tert-butyl N-[3-(4-pyrimidin-5-yl-3-pyridinyl)prop-2-ynyl]carbamate (PubChem CID 151276183) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is tert-butyl N-[3-(4-pyrimidin-5-yl-3-pyridinyl)prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-pyrimidin-5-yl-3-pyridinyl)prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 151276183 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | tert-butyl N-[3-(4-pyrimidin-5-yl-3-pyridinyl)prop-2-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC#Cc1cnccc1-c1cncnc1 |
| InChI | InChI=1S/C17H18N4O2/c1-17(2,3)23-16(22)21-7-4-5-13-9-18-8-6-15(13)14-10-19-12-20-11-14/h6,8-12H,7H2,1-3H3,(H,21,22) |
| InChIKey | NXJWBCGOTJAXIL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|