C21H15ClN2O — CID 151277453
2-(2-chlorophenyl)-4,5-diphenylimidazol-2-ol (PubChem CID 151277453) has the molecular formula C21H15ClN2O and a molecular weight of 346.82 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4,5-diphenylimidazol-2-ol.
| Compound Name | 2-(2-chlorophenyl)-4,5-diphenylimidazol-2-ol |
|---|---|
| PubChem CID | 151277453 |
| Molecular Formula | C21H15ClN2O |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-(2-chlorophenyl)-4,5-diphenylimidazol-2-ol |
| SMILES | OC1(c2ccccc2Cl)N=C(c2ccccc2)C(c2ccccc2)=N1 |
| InChI | InChI=1S/C21H15ClN2O/c22-18-14-8-7-13-17(18)21(25)23-19(15-9-3-1-4-10-15)20(24-21)16-11-5-2-6-12-16/h1-14,25H |
| InChIKey | NXQPUXNLNCDYSB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |