C23H17ClFN3O — CID 71492821
(E)-N-[(2-chlorophenyl)methoxy]-1-[5-(4-fluorophenyl)-2-phenyl-2H-imidazol-4-yl]methanimine (PubChem CID 71492821) has the molecular formula C23H17ClFN3O and a molecular weight of 405.86 g/mol. Its IUPAC name is (E)-N-[(2-chlorophenyl)methoxy]-1-[5-(4-fluorophenyl)-2-phenyl-2H-imidazol-4-yl]methanimine.
| Compound Name | (E)-N-[(2-chlorophenyl)methoxy]-1-[5-(4-fluorophenyl)-2-phenyl-2H-imidazol-4-yl]methanimine |
|---|---|
| PubChem CID | 71492821 |
| Molecular Formula | C23H17ClFN3O |
| Molecular Weight | 405.86 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (E)-N-[(2-chlorophenyl)methoxy]-1-[5-(4-fluorophenyl)-2-phenyl-2H-imidazol-4-yl]methanimine |
| SMILES | Fc1ccc(C2=NC(c3ccccc3)N=C2/C=N/OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C23H17ClFN3O/c24-20-9-5-4-8-18(20)15-29-26-14-21-22(16-10-12-19(25)13-11-16)28-23(27-21)17-6-2-1-3-7-17/h1-14,23H,15H2/b26-14+ |
| InChIKey | LFGCAQDMMOHCHR-VULFUBBASA-N |
| XLogP | 5.62 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.86 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|