C23H16Cl2FN3O — CID 71492822
(E)-N-[(2,4-dichlorophenyl)methoxy]-1-[5-(4-fluorophenyl)-2-phenyl-2H-imidazol-4-yl]methanimine (PubChem CID 71492822) has the molecular formula C23H16Cl2FN3O and a molecular weight of 440.31 g/mol. Its IUPAC name is (E)-N-[(2,4-dichlorophenyl)methoxy]-1-[5-(4-fluorophenyl)-2-phenyl-2H-imidazol-4-yl]methanimine.
| Compound Name | (E)-N-[(2,4-dichlorophenyl)methoxy]-1-[5-(4-fluorophenyl)-2-phenyl-2H-imidazol-4-yl]methanimine |
|---|---|
| PubChem CID | 71492822 |
| Molecular Formula | C23H16Cl2FN3O |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (E)-N-[(2,4-dichlorophenyl)methoxy]-1-[5-(4-fluorophenyl)-2-phenyl-2H-imidazol-4-yl]methanimine |
| SMILES | Fc1ccc(C2=NC(c3ccccc3)N=C2/C=N/OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H16Cl2FN3O/c24-18-9-6-17(20(25)12-18)14-30-27-13-21-22(15-7-10-19(26)11-8-15)29-23(28-21)16-4-2-1-3-5-16/h1-13,23H,14H2/b27-13+ |
| InChIKey | XUFXEJXNWFURRW-UVHMKAGCSA-N |
| XLogP | 6.28 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|