C23H18FN3O — CID 71492479
(E)-1-(2,5-diphenyl-2H-imidazol-4-yl)-N-[(2-fluorophenyl)methoxy]methanimine (PubChem CID 71492479) has the molecular formula C23H18FN3O and a molecular weight of 371.42 g/mol. Its IUPAC name is (E)-1-(2,5-diphenyl-2H-imidazol-4-yl)-N-[(2-fluorophenyl)methoxy]methanimine.
| Compound Name | (E)-1-(2,5-diphenyl-2H-imidazol-4-yl)-N-[(2-fluorophenyl)methoxy]methanimine |
|---|---|
| PubChem CID | 71492479 |
| Molecular Formula | C23H18FN3O |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | (E)-1-(2,5-diphenyl-2H-imidazol-4-yl)-N-[(2-fluorophenyl)methoxy]methanimine |
| SMILES | Fc1ccccc1CO/N=C/C1=NC(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C23H18FN3O/c24-20-14-8-7-13-19(20)16-28-25-15-21-22(17-9-3-1-4-10-17)27-23(26-21)18-11-5-2-6-12-18/h1-15,23H,16H2/b25-15+ |
| InChIKey | MYQYMIXBZYSCDA-MFKUBSTISA-N |
| XLogP | 4.97 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|