C19H22N2O — CID 86248628
5-butyl-3,6-diphenyl-4,6-dihydro-1,2,5-oxadiazine (PubChem CID 86248628) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 5-butyl-3,6-diphenyl-4,6-dihydro-1,2,5-oxadiazine.
| Compound Name | 5-butyl-3,6-diphenyl-4,6-dihydro-1,2,5-oxadiazine |
|---|---|
| PubChem CID | 86248628 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 5-butyl-3,6-diphenyl-4,6-dihydro-1,2,5-oxadiazine |
| SMILES | CCCCN1CC(c2ccccc2)=NOC1c1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c1-2-3-14-21-15-18(16-10-6-4-7-11-16)20-22-19(21)17-12-8-5-9-13-17/h4-13,19H,2-3,14-15H2,1H3 |
| InChIKey | FFMLELUPDDTUKQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |