C27H30N2O — CID 45269553
(E)-2,6-diphenyl-N-phenylmethoxy-3-propan-2-ylpiperidin-4-imine (PubChem CID 45269553) has the molecular formula C27H30N2O and a molecular weight of 398.55 g/mol. Its IUPAC name is (E)-2,6-diphenyl-N-phenylmethoxy-3-propan-2-ylpiperidin-4-imine.
| Compound Name | (E)-2,6-diphenyl-N-phenylmethoxy-3-propan-2-ylpiperidin-4-imine |
|---|---|
| PubChem CID | 45269553 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | (E)-2,6-diphenyl-N-phenylmethoxy-3-propan-2-ylpiperidin-4-imine |
| SMILES | CC(C)C1/C(=N/OCc2ccccc2)CC(c2ccccc2)NC1c1ccccc1 |
| InChI | InChI=1S/C27H30N2O/c1-20(2)26-25(29-30-19-21-12-6-3-7-13-21)18-24(22-14-8-4-9-15-22)28-27(26)23-16-10-5-11-17-23/h3-17,20,24,26-28H,18-19H2,1-2H3/b29-25+ |
| InChIKey | DPGZQBXBTVGXHI-XLVZBRSZSA-N |
| XLogP | 6.31 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|