C24H22Cl2N2O — CID 45267034
2,6-bis(4-chlorophenyl)-N-phenylmethoxypiperidin-4-imine (PubChem CID 45267034) has the molecular formula C24H22Cl2N2O and a molecular weight of 425.36 g/mol. Its IUPAC name is 2,6-bis(4-chlorophenyl)-N-phenylmethoxypiperidin-4-imine.
| Compound Name | 2,6-bis(4-chlorophenyl)-N-phenylmethoxypiperidin-4-imine |
|---|---|
| PubChem CID | 45267034 |
| Molecular Formula | C24H22Cl2N2O |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 2,6-bis(4-chlorophenyl)-N-phenylmethoxypiperidin-4-imine |
| SMILES | Clc1ccc(C2CC(=NOCc3ccccc3)CC(c3ccc(Cl)cc3)N2)cc1 |
| InChI | InChI=1S/C24H22Cl2N2O/c25-20-10-6-18(7-11-20)23-14-22(28-29-16-17-4-2-1-3-5-17)15-24(27-23)19-8-12-21(26)13-9-19/h1-13,23-24,27H,14-16H2 |
| InChIKey | ZGQHLDBYJQFBSW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|