C17H16Cl2FN3O — CID 2805417
4-chloro-N'-[(2-chloro-6-fluorophenyl)methoxy]-N-(dimethylaminomethylidene)benzenecarboximidamide (PubChem CID 2805417) has the molecular formula C17H16Cl2FN3O and a molecular weight of 368.24 g/mol. Its IUPAC name is 4-chloro-N'-[(2-chloro-6-fluorophenyl)methoxy]-N-(dimethylaminomethylidene)benzenecarboximidamide.
| Compound Name | 4-chloro-N'-[(2-chloro-6-fluorophenyl)methoxy]-N-(dimethylaminomethylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 2805417 |
| Molecular Formula | C17H16Cl2FN3O |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 4-chloro-N'-[(2-chloro-6-fluorophenyl)methoxy]-N-(dimethylaminomethylidene)benzenecarboximidamide |
| SMILES | CN(C)/C=N/C(=NOCc1c(F)cccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2FN3O/c1-23(2)11-21-17(12-6-8-13(18)9-7-12)22-24-10-14-15(19)4-3-5-16(14)20/h3-9,11H,10H2,1-2H3/b21-11+,22-17? |
| InChIKey | XGIYMKFRLFPLRV-HGNWFRPISA-N |
| XLogP | 4.60 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|