C15H12Cl2FN3O2 — CID 2805418
4-chloro-N-[(2-chloro-6-fluorophenyl)methoxy]-N'-(hydroxyiminomethyl)benzenecarboximidamide (PubChem CID 2805418) has the molecular formula C15H12Cl2FN3O2 and a molecular weight of 356.18 g/mol. Its IUPAC name is 4-chloro-N-[(2-chloro-6-fluorophenyl)methoxy]-N'-(hydroxyiminomethyl)benzenecarboximidamide.
| Compound Name | 4-chloro-N-[(2-chloro-6-fluorophenyl)methoxy]-N'-(hydroxyiminomethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 2805418 |
| Molecular Formula | C15H12Cl2FN3O2 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 4-chloro-N-[(2-chloro-6-fluorophenyl)methoxy]-N'-(hydroxyiminomethyl)benzenecarboximidamide |
| SMILES | ON=C/N=C(/NOCc1c(F)cccc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12Cl2FN3O2/c16-11-6-4-10(5-7-11)15(19-9-20-22)21-23-8-12-13(17)2-1-3-14(12)18/h1-7,9,22H,8H2,(H,19,20,21) |
| InChIKey | LPUSFWAFXAZMBM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|