C24H20ClN3O — CID 71492637
(E)-N-[(2-chlorophenyl)methoxy]-1-[5-(4-methylphenyl)-2-phenyl-2H-imidazol-4-yl]methanimine (PubChem CID 71492637) has the molecular formula C24H20ClN3O and a molecular weight of 401.90 g/mol. Its IUPAC name is (E)-N-[(2-chlorophenyl)methoxy]-1-[5-(4-methylphenyl)-2-phenyl-2H-imidazol-4-yl]methanimine.
| Compound Name | (E)-N-[(2-chlorophenyl)methoxy]-1-[5-(4-methylphenyl)-2-phenyl-2H-imidazol-4-yl]methanimine |
|---|---|
| PubChem CID | 71492637 |
| Molecular Formula | C24H20ClN3O |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (E)-N-[(2-chlorophenyl)methoxy]-1-[5-(4-methylphenyl)-2-phenyl-2H-imidazol-4-yl]methanimine |
| SMILES | Cc1ccc(C2=NC(c3ccccc3)N=C2/C=N/OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C24H20ClN3O/c1-17-11-13-18(14-12-17)23-22(27-24(28-23)19-7-3-2-4-8-19)15-26-29-16-20-9-5-6-10-21(20)25/h2-15,24H,16H2,1H3/b26-15+ |
| InChIKey | YSFXIIHYTQJJMD-CVKSISIWSA-N |
| XLogP | 5.79 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|