C23H17Cl2N3O — CID 71492480
(E)-N-[(2,4-dichlorophenyl)methoxy]-1-(2,5-diphenyl-2H-imidazol-4-yl)methanimine (PubChem CID 71492480) has the molecular formula C23H17Cl2N3O and a molecular weight of 422.32 g/mol. Its IUPAC name is (E)-N-[(2,4-dichlorophenyl)methoxy]-1-(2,5-diphenyl-2H-imidazol-4-yl)methanimine.
| Compound Name | (E)-N-[(2,4-dichlorophenyl)methoxy]-1-(2,5-diphenyl-2H-imidazol-4-yl)methanimine |
|---|---|
| PubChem CID | 71492480 |
| Molecular Formula | C23H17Cl2N3O |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | (E)-N-[(2,4-dichlorophenyl)methoxy]-1-(2,5-diphenyl-2H-imidazol-4-yl)methanimine |
| SMILES | Clc1ccc(CO/N=C/C2=NC(c3ccccc3)N=C2c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2N3O/c24-19-12-11-18(20(25)13-19)15-29-26-14-21-22(16-7-3-1-4-8-16)28-23(27-21)17-9-5-2-6-10-17/h1-14,23H,15H2/b26-14+ |
| InChIKey | IBXKEGQEXKUZCE-VULFUBBASA-N |
| XLogP | 6.14 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|