C21H14Cl2N2O — CID 15311758
4-(2,4-dichlorophenyl)-2,6-diphenyl-4H-1,3,5-oxadiazine (PubChem CID 15311758) has the molecular formula C21H14Cl2N2O and a molecular weight of 381.26 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2,6-diphenyl-4H-1,3,5-oxadiazine.
| Compound Name | 4-(2,4-dichlorophenyl)-2,6-diphenyl-4H-1,3,5-oxadiazine |
|---|---|
| PubChem CID | 15311758 |
| Molecular Formula | C21H14Cl2N2O |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-2,6-diphenyl-4H-1,3,5-oxadiazine |
| SMILES | Clc1ccc(C2N=C(c3ccccc3)OC(c3ccccc3)=N2)c(Cl)c1 |
| InChI | InChI=1S/C21H14Cl2N2O/c22-16-11-12-17(18(23)13-16)19-24-20(14-7-3-1-4-8-14)26-21(25-19)15-9-5-2-6-10-15/h1-13,19H |
| InChIKey | FNBUGVFWKPTYKR-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |