C23H16Cl3N3O — CID 71493004
(E)-1-[5-(4-chlorophenyl)-2-phenyl-2H-imidazol-4-yl]-N-[(2,4-dichlorophenyl)methoxy]methanimine (PubChem CID 71493004) has the molecular formula C23H16Cl3N3O and a molecular weight of 456.76 g/mol. Its IUPAC name is (E)-1-[5-(4-chlorophenyl)-2-phenyl-2H-imidazol-4-yl]-N-[(2,4-dichlorophenyl)methoxy]methanimine.
| Compound Name | (E)-1-[5-(4-chlorophenyl)-2-phenyl-2H-imidazol-4-yl]-N-[(2,4-dichlorophenyl)methoxy]methanimine |
|---|---|
| PubChem CID | 71493004 |
| Molecular Formula | C23H16Cl3N3O |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | (E)-1-[5-(4-chlorophenyl)-2-phenyl-2H-imidazol-4-yl]-N-[(2,4-dichlorophenyl)methoxy]methanimine |
| SMILES | Clc1ccc(C2=NC(c3ccccc3)N=C2/C=N/OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C23H16Cl3N3O/c24-18-9-6-15(7-10-18)22-21(28-23(29-22)16-4-2-1-3-5-16)13-27-30-14-17-8-11-19(25)12-20(17)26/h1-13,23H,14H2/b27-13+ |
| InChIKey | WFTNDTRFIJIJOJ-UVHMKAGCSA-N |
| XLogP | 6.79 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|