C23H19N3O — CID 71492478
(E)-1-(2,5-diphenyl-2H-imidazol-4-yl)-N-phenylmethoxymethanimine (PubChem CID 71492478) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is (E)-1-(2,5-diphenyl-2H-imidazol-4-yl)-N-phenylmethoxymethanimine.
| Compound Name | (E)-1-(2,5-diphenyl-2H-imidazol-4-yl)-N-phenylmethoxymethanimine |
|---|---|
| PubChem CID | 71492478 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (E)-1-(2,5-diphenyl-2H-imidazol-4-yl)-N-phenylmethoxymethanimine |
| SMILES | C(=N/OCc1ccccc1)\C1=NC(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C23H19N3O/c1-4-10-18(11-5-1)17-27-24-16-21-22(19-12-6-2-7-13-19)26-23(25-21)20-14-8-3-9-15-20/h1-16,23H,17H2/b24-16+ |
| InChIKey | WGQZFVLABNWFDH-LFVJCYFKSA-N |
| XLogP | 4.83 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|