C11H12F4OS — CID 151281984
1-propoxy-4-(1,1,2,2-tetrafluoroethylsulfanyl)benzene (PubChem CID 151281984) has the molecular formula C11H12F4OS and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-propoxy-4-(1,1,2,2-tetrafluoroethylsulfanyl)benzene.
| Compound Name | 1-propoxy-4-(1,1,2,2-tetrafluoroethylsulfanyl)benzene |
|---|---|
| PubChem CID | 151281984 |
| Molecular Formula | C11H12F4OS |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 1-propoxy-4-(1,1,2,2-tetrafluoroethylsulfanyl)benzene |
| SMILES | CCCOc1ccc(SC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C11H12F4OS/c1-2-7-16-8-3-5-9(6-4-8)17-11(14,15)10(12)13/h3-6,10H,2,7H2,1H3 |
| InChIKey | NYOXPTQTTGMBGC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|