C8H12N2O2S3 — CID 151294341
1,6-diisocyanatohexane-2,2,4-trithiol (PubChem CID 151294341) has the molecular formula C8H12N2O2S3 and a molecular weight of 264.40 g/mol. Its IUPAC name is 1,6-diisocyanatohexane-2,2,4-trithiol.
| Compound Name | 1,6-diisocyanatohexane-2,2,4-trithiol |
|---|---|
| PubChem CID | 151294341 |
| Molecular Formula | C8H12N2O2S3 |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | 1,6-diisocyanatohexane-2,2,4-trithiol |
| SMILES | O=C=NCCC(S)CC(S)(S)CN=C=O |
| InChI | InChI=1S/C8H12N2O2S3/c11-5-9-2-1-7(13)3-8(14,15)4-10-6-12/h7,13-15H,1-4H2 |
| InChIKey | OBBVDOCHHDVYEA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|